C27H12F4Li2N2O11S2 — CID 135564337
dilithium;3-amino-9-[2-carboxy-4-(2,3,5,6-tetrafluorophenoxy)carbonylphenyl]-6-iminoxanthene-4,5-disulfonate (PubChem CID 135564337) has the molecular formula C27H12F4Li2N2O11S2 and a molecular weight of 694.40 g/mol. Its IUPAC name is dilithium;3-amino-9-[2-carboxy-4-(2,3,5,6-tetrafluorophenoxy)carbonylphenyl]-6-iminoxanthene-4,5-disulfonate.
| Compound Name | dilithium;3-amino-9-[2-carboxy-4-(2,3,5,6-tetrafluorophenoxy)carbonylphenyl]-6-iminoxanthene-4,5-disulfonate |
|---|---|
| PubChem CID | 135564337 |
| Molecular Formula | C27H12F4Li2N2O11S2 |
| Molecular Weight | 694.40 g/mol |
| Exact Mass | 694.01 |
| IUPAC Name | dilithium;3-amino-9-[2-carboxy-4-(2,3,5,6-tetrafluorophenoxy)carbonylphenyl]-6-iminoxanthene-4,5-disulfonate |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)Oc4c(F)c(F)cc(F)c4F)cc3C(=O)O)c3ccc(N)c(S(=O)(=O)[O-])c3oc-2c1S(=O)(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C27H14F4N2O11S2.2Li/c28-14-8-15(29)20(31)23(19(14)30)44-27(36)9-1-2-10(13(7-9)26(34)35)18-11-3-5-16(32)24(45(37,38)39)21(11)43-22-12(18)4-6-17(33)25(22)46(40,41)42;;/h1-8,32H,33H2,(H,34,35)(H,37,38,39)(H,40,41,42);;/q;2*+1/p-2/b32-16+;; |
| InChIKey | KMKSKUKSDZYSCI-AIFRZVFVSA-L |
| XLogP | -2.44 |
| TPSA | 241.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.40 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|