C23H17N2O10S2-3 — CID 158118313
2-(3-amino-6-imino-4,5-disulfonatoxanthen-9-yl)benzoate;propan-2-one (PubChem CID 158118313) has the molecular formula C23H17N2O10S2-3 and a molecular weight of 545.53 g/mol. Its IUPAC name is 2-(3-amino-6-imino-4,5-disulfonatoxanthen-9-yl)benzoate;propan-2-one.
| Compound Name | 2-(3-amino-6-imino-4,5-disulfonatoxanthen-9-yl)benzoate;propan-2-one |
|---|---|
| PubChem CID | 158118313 |
| Molecular Formula | C23H17N2O10S2-3 |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.03 |
| IUPAC Name | 2-(3-amino-6-imino-4,5-disulfonatoxanthen-9-yl)benzoate;propan-2-one |
| SMILES | CC(C)=O.[H]/N=c1\ccc2c(-c3ccccc3C(=O)[O-])c3ccc(N)c(S(=O)(=O)[O-])c3oc-2c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C20H14N2O9S2.C3H6O/c21-13-7-5-11-15(9-3-1-2-4-10(9)20(23)24)12-6-8-14(22)19(33(28,29)30)17(12)31-16(11)18(13)32(25,26)27;1-3(2)4/h1-8,21H,22H2,(H,23,24)(H,25,26,27)(H,28,29,30);1-2H3/p-3/b21-13+; |
| InChIKey | FRHIVFNAGDIOAV-PGCULMPHSA-K |
| XLogP | 1.03 |
| TPSA | 234.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|