C34H40N3O10S2-3 — CID 161073307
2-[3-amino-4-[5-carboxylatopentyl(heptyl)sulfamoyl]-6-imino-5-sulfonatoxanthen-9-yl]benzoate;methane (PubChem CID 161073307) has the molecular formula C34H40N3O10S2-3 and a molecular weight of 714.84 g/mol. Its IUPAC name is 2-[3-amino-4-[5-carboxylatopentyl(heptyl)sulfamoyl]-6-imino-5-sulfonatoxanthen-9-yl]benzoate;methane.
| Compound Name | 2-[3-amino-4-[5-carboxylatopentyl(heptyl)sulfamoyl]-6-imino-5-sulfonatoxanthen-9-yl]benzoate;methane |
|---|---|
| PubChem CID | 161073307 |
| Molecular Formula | C34H40N3O10S2-3 |
| Molecular Weight | 714.84 g/mol |
| Exact Mass | 714.22 |
| IUPAC Name | 2-[3-amino-4-[5-carboxylatopentyl(heptyl)sulfamoyl]-6-imino-5-sulfonatoxanthen-9-yl]benzoate;methane |
| SMILES | C.[H]/N=c1\ccc2c(-c3ccccc3C(=O)[O-])c3ccc(N)c(S(=O)(=O)N(CCCCCCC)CCCCCC(=O)[O-])c3oc-2c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C33H39N3O10S2.CH4/c1-2-3-4-5-10-19-36(20-11-6-7-14-27(37)38)47(41,42)31-25(34)17-15-23-28(21-12-8-9-13-22(21)33(39)40)24-16-18-26(35)32(48(43,44)45)30(24)46-29(23)31;/h8-9,12-13,15-18,35H,2-7,10-11,14,19-20,34H2,1H3,(H,37,38)(H,39,40)(H,43,44,45);1H4/p-3/b35-26+; |
| InChIKey | OXTIDFROKSQFPE-SYJWNPINSA-K |
| XLogP | 3.44 |
| TPSA | 237.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|