C35H37N5O14S3 — CID 59435230
2-[3-amino-4-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-(3-sulfopropyl)sulfamoyl]-6-imino-5-sulfoxanthen-9-yl]benzoic acid (PubChem CID 59435230) has the molecular formula C35H37N5O14S3 and a molecular weight of 847.90 g/mol. Its IUPAC name is 2-[3-amino-4-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-(3-sulfopropyl)sulfamoyl]-6-imino-5-sulfoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-amino-4-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-(3-sulfopropyl)sulfamoyl]-6-imino-5-sulfoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 59435230 |
| Molecular Formula | C35H37N5O14S3 |
| Molecular Weight | 847.90 g/mol |
| Exact Mass | 847.15 |
| IUPAC Name | 2-[3-amino-4-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-(3-sulfopropyl)sulfamoyl]-6-imino-5-sulfoxanthen-9-yl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccccc3C(=O)O)c3ccc(N)c(S(=O)(=O)N(CCCCCC(=O)NCCN4C(=O)C=CC4=O)CCCS(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C35H37N5O14S3/c36-25-12-10-23-30(21-7-3-4-8-22(21)35(44)45)24-11-13-26(37)34(57(51,52)53)32(24)54-31(23)33(25)56(49,50)39(18-6-20-55(46,47)48)17-5-1-2-9-27(41)38-16-19-40-28(42)14-15-29(40)43/h3-4,7-8,10-15,37H,1-2,5-6,9,16-20,36H2,(H,38,41)(H,44,45)(H,46,47,48)(H,51,52,53)/b37-26+ |
| InChIKey | DFWOEQWZQORRCO-AVLPFNLUSA-N |
| XLogP | 2.08 |
| TPSA | 312.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.90 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|