C40H53N3O17S2 — CID 59435252
2-[3-amino-6-imino-4-[2-[2-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]-5-sulfoxanthen-9-yl]benzoic acid (PubChem CID 59435252) has the molecular formula C40H53N3O17S2 and a molecular weight of 912.00 g/mol. Its IUPAC name is 2-[3-amino-6-imino-4-[2-[2-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]-5-sulfoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-amino-6-imino-4-[2-[2-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]-5-sulfoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 59435252 |
| Molecular Formula | C40H53N3O17S2 |
| Molecular Weight | 912.00 g/mol |
| Exact Mass | 911.28 |
| IUPAC Name | 2-[3-amino-6-imino-4-[2-[2-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]-5-sulfoxanthen-9-yl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccccc3C(=O)O)c3ccc(N)c(S(=O)(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(C)=O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C40H53N3O17S2/c1-28(44)10-12-52-14-16-54-18-20-56-22-24-58-26-27-59-25-23-57-21-19-55-17-15-53-13-11-43-61(47,48)38-33(41)8-6-31-35(29-4-2-3-5-30(29)40(45)46)32-7-9-34(42)39(62(49,50)51)37(32)60-36(31)38/h2-9,42-43H,10-27,41H2,1H3,(H,45,46)(H,49,50,51)/b42-34+ |
| InChIKey | PGSOKYCCPDLZDI-GGGSGSEDSA-N |
| XLogP | 2.60 |
| TPSA | 291.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.00 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|