C24H22N5O14PS2 — CID 134217073
2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[(1-hydrazinyl-1-oxo-3-phosphonopropan-2-yl)carbamoyl]benzoic acid (PubChem CID 134217073) has the molecular formula C24H22N5O14PS2 and a molecular weight of 699.57 g/mol. Its IUPAC name is 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[(1-hydrazinyl-1-oxo-3-phosphonopropan-2-yl)carbamoyl]benzoic acid.
| Compound Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[(1-hydrazinyl-1-oxo-3-phosphonopropan-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 134217073 |
| Molecular Formula | C24H22N5O14PS2 |
| Molecular Weight | 699.57 g/mol |
| Exact Mass | 699.03 |
| IUPAC Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[(1-hydrazinyl-1-oxo-3-phosphonopropan-2-yl)carbamoyl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)NC(CP(=O)(O)O)C(=O)NN)cc3C(=O)O)c3ccc(N)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C24H22N5O14PS2/c25-14-5-3-11-17(12-4-6-15(26)21(46(40,41)42)19(12)43-18(11)20(14)45(37,38)39)10-2-1-9(7-13(10)24(32)33)22(30)28-16(23(31)29-27)8-44(34,35)36/h1-7,16,25H,8,26-27H2,(H,28,30)(H,29,31)(H,32,33)(H2,34,35,36)(H,37,38,39)(H,40,41,42)/b25-14+ |
| InChIKey | MIEUYOSUNMPIEZ-AFUMVMLFSA-N |
| XLogP | -0.28 |
| TPSA | 350.80 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.57 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|