C27H21N5O14S3 — CID 140826967
2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[(1-oxo-1-pyrazol-1-yl-3-sulfopropan-2-yl)carbamoyl]benzoic acid (PubChem CID 140826967) has the molecular formula C27H21N5O14S3 and a molecular weight of 735.69 g/mol. Its IUPAC name is 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[(1-oxo-1-pyrazol-1-yl-3-sulfopropan-2-yl)carbamoyl]benzoic acid.
| Compound Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[(1-oxo-1-pyrazol-1-yl-3-sulfopropan-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 140826967 |
| Molecular Formula | C27H21N5O14S3 |
| Molecular Weight | 735.69 g/mol |
| Exact Mass | 735.02 |
| IUPAC Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-5-[(1-oxo-1-pyrazol-1-yl-3-sulfopropan-2-yl)carbamoyl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)NC(CS(=O)(=O)O)C(=O)n4cccn4)cc3C(=O)O)c3ccc(N)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C27H21N5O14S3/c28-17-6-4-14-20(15-5-7-18(29)24(49(43,44)45)22(15)46-21(14)23(17)48(40,41)42)13-3-2-12(10-16(13)27(35)36)25(33)31-19(11-47(37,38)39)26(34)32-9-1-8-30-32/h1-10,19,28H,11,29H2,(H,31,33)(H,35,36)(H,37,38,39)(H,40,41,42)(H,43,44,45)/b28-17+ |
| InChIKey | AHXSKMZDGRIDOA-OGLMXYFKSA-N |
| XLogP | 0.98 |
| TPSA | 327.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.69 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|