C24H17N3O9S2 — CID 137482660
3-amino-9-[2-formyl-4-(prop-2-ynylcarbamoyl)phenyl]-6-iminoxanthene-4,5-disulfonic acid (PubChem CID 137482660) has the molecular formula C24H17N3O9S2 and a molecular weight of 555.55 g/mol. Its IUPAC name is 3-amino-9-[2-formyl-4-(prop-2-ynylcarbamoyl)phenyl]-6-iminoxanthene-4,5-disulfonic acid.
| Compound Name | 3-amino-9-[2-formyl-4-(prop-2-ynylcarbamoyl)phenyl]-6-iminoxanthene-4,5-disulfonic acid |
|---|---|
| PubChem CID | 137482660 |
| Molecular Formula | C24H17N3O9S2 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | 3-amino-9-[2-formyl-4-(prop-2-ynylcarbamoyl)phenyl]-6-iminoxanthene-4,5-disulfonic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)NCC#C)cc3C=O)c3ccc(N)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C24H17N3O9S2/c1-2-9-27-24(29)12-3-4-14(13(10-12)11-28)19-15-5-7-17(25)22(37(30,31)32)20(15)36-21-16(19)6-8-18(26)23(21)38(33,34)35/h1,3-8,10-11,25H,9,26H2,(H,27,29)(H,30,31,32)(H,33,34,35)/b25-17+ |
| InChIKey | VDWQLMLEHLRZRB-KOEQRZSOSA-N |
| XLogP | 1.94 |
| TPSA | 217.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|