C27H26N6O3S2 — CID 89255730
4-[3-amino-6-imino-4,5-bis(sulfanyl)xanthen-9-yl]-N-(6-azidohexyl)-3-formylbenzamide (PubChem CID 89255730) has the molecular formula C27H26N6O3S2 and a molecular weight of 546.68 g/mol. Its IUPAC name is 4-[3-amino-6-imino-4,5-bis(sulfanyl)xanthen-9-yl]-N-(6-azidohexyl)-3-formylbenzamide.
| Compound Name | 4-[3-amino-6-imino-4,5-bis(sulfanyl)xanthen-9-yl]-N-(6-azidohexyl)-3-formylbenzamide |
|---|---|
| PubChem CID | 89255730 |
| Molecular Formula | C27H26N6O3S2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 4-[3-amino-6-imino-4,5-bis(sulfanyl)xanthen-9-yl]-N-(6-azidohexyl)-3-formylbenzamide |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)NCCCCCCN=[N+]=[N-])cc3C=O)c3ccc(N)c(S)c3oc-2c1S |
| InChI | InChI=1S/C27H26N6O3S2/c28-20-9-7-18-22(19-8-10-21(29)26(38)24(19)36-23(18)25(20)37)17-6-5-15(13-16(17)14-34)27(35)31-11-3-1-2-4-12-32-33-30/h5-10,13-14,28,37-38H,1-4,11-12,29H2,(H,31,35)/b28-20+ |
| InChIKey | ZFWUDSKOOXQQRR-VFCFBJKWSA-N |
| XLogP | 6.26 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|