C34H35N5O16S3 — CID 90690488
2-[3-amino-6-imino-5-sulfo-4-(3-sulfopropylsulfamoyl)xanthen-9-yl]-5-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]carbamoyl]benzoic acid (PubChem CID 90690488) has the molecular formula C34H35N5O16S3 and a molecular weight of 865.87 g/mol. Its IUPAC name is 2-[3-amino-6-imino-5-sulfo-4-(3-sulfopropylsulfamoyl)xanthen-9-yl]-5-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]carbamoyl]benzoic acid.
| Compound Name | 2-[3-amino-6-imino-5-sulfo-4-(3-sulfopropylsulfamoyl)xanthen-9-yl]-5-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 90690488 |
| Molecular Formula | C34H35N5O16S3 |
| Molecular Weight | 865.87 g/mol |
| Exact Mass | 865.12 |
| IUPAC Name | 2-[3-amino-6-imino-5-sulfo-4-(3-sulfopropylsulfamoyl)xanthen-9-yl]-5-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]carbamoyl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)NCCCCCC(=O)On4c(O)ccc4O)cc3C(=O)O)c3ccc(N)c(S(=O)(=O)NCCCS(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C34H35N5O16S3/c35-23-10-8-20-28(21-9-11-24(36)32(58(51,52)53)30(21)54-29(20)31(23)57(49,50)38-15-4-16-56(46,47)48)19-7-6-18(17-22(19)34(44)45)33(43)37-14-3-1-2-5-27(42)55-39-25(40)12-13-26(39)41/h6-13,17,36,38,40-41H,1-5,14-16,35H2,(H,37,43)(H,44,45)(H,46,47,48)(H,51,52,53)/b36-24+ |
| InChIKey | RWWVOQOWQYZHIG-XBQJKBNESA-N |
| XLogP | 1.93 |
| TPSA | 356.01 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.87 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|