C27H26F3N3O15S3 — CID 158723642
[6-amino-9-(2,4-dicarboxyphenyl)-4-sulfo-5-(3-sulfopropylsulfamoyl)xanthen-3-ylidene]azanium;methane;2,2,2-trifluoroacetate (PubChem CID 158723642) has the molecular formula C27H26F3N3O15S3 and a molecular weight of 785.71 g/mol. Its IUPAC name is [6-amino-9-(2,4-dicarboxyphenyl)-4-sulfo-5-(3-sulfopropylsulfamoyl)xanthen-3-ylidene]azanium;methane;2,2,2-trifluoroacetate.
| Compound Name | [6-amino-9-(2,4-dicarboxyphenyl)-4-sulfo-5-(3-sulfopropylsulfamoyl)xanthen-3-ylidene]azanium;methane;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 158723642 |
| Molecular Formula | C27H26F3N3O15S3 |
| Molecular Weight | 785.71 g/mol |
| Exact Mass | 785.05 |
| IUPAC Name | [6-amino-9-(2,4-dicarboxyphenyl)-4-sulfo-5-(3-sulfopropylsulfamoyl)xanthen-3-ylidene]azanium;methane;2,2,2-trifluoroacetate |
| SMILES | C.Nc1ccc2c(-c3ccc(C(=O)O)cc3C(=O)O)c3ccc(=[NH2+])c(S(=O)(=O)O)c-3oc2c1S(=O)(=O)NCCCS(=O)(=O)O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H21N3O13S3.C2HF3O2.CH4/c25-16-6-4-13-18(12-3-2-11(23(28)29)10-15(12)24(30)31)14-5-7-17(26)22(43(37,38)39)20(14)40-19(13)21(16)42(35,36)27-8-1-9-41(32,33)34;3-2(4,5)1(6)7;/h2-7,10,26-27H,1,8-9,25H2,(H,28,29)(H,30,31)(H,32,33,34)(H,37,38,39);(H,6,7);1H4 |
| InChIKey | URWLYVBHQSPIAQ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 334.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.71 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|