C27H28N3O9S2+ — CID 170539860
[6-amino-9-[2-[ethyl(methyl)carbamoyl]-4-(2-methylpropanoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium (PubChem CID 170539860) has the molecular formula C27H28N3O9S2+ and a molecular weight of 602.67 g/mol. Its IUPAC name is [6-amino-9-[2-[ethyl(methyl)carbamoyl]-4-(2-methylpropanoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium.
| Compound Name | [6-amino-9-[2-[ethyl(methyl)carbamoyl]-4-(2-methylpropanoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 170539860 |
| Molecular Formula | C27H28N3O9S2+ |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | [6-amino-9-[2-[ethyl(methyl)carbamoyl]-4-(2-methylpropanoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium |
| SMILES | CCN(C)C(=O)c1cc(C(=O)C(C)C)ccc1-c1c2ccc(=[NH2+])c(S(=O)(=O)O)c-2oc2c(S(=O)(=O)O)c(N)ccc12 |
| InChI | InChI=1S/C27H27N3O9S2/c1-5-30(4)27(32)18-12-14(22(31)13(2)3)6-7-15(18)21-16-8-10-19(28)25(40(33,34)35)23(16)39-24-17(21)9-11-20(29)26(24)41(36,37)38/h6-13,28H,5,29H2,1-4H3,(H,33,34,35)(H,36,37,38)/p+1 |
| InChIKey | GAYSKJKHFLZEMS-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 210.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|