C24H21N2O10S2+ — CID 170539868
[6-amino-9-[2-formyloxy-4-(2-methylpropanoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium (PubChem CID 170539868) has the molecular formula C24H21N2O10S2+ and a molecular weight of 561.57 g/mol. Its IUPAC name is [6-amino-9-[2-formyloxy-4-(2-methylpropanoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium.
| Compound Name | [6-amino-9-[2-formyloxy-4-(2-methylpropanoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 170539868 |
| Molecular Formula | C24H21N2O10S2+ |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.06 |
| IUPAC Name | [6-amino-9-[2-formyloxy-4-(2-methylpropanoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium |
| SMILES | CC(C)C(=O)c1ccc(-c2c3ccc(=[NH2+])c(S(=O)(=O)O)c-3oc3c(S(=O)(=O)O)c(N)ccc23)c(OC=O)c1 |
| InChI | InChI=1S/C24H20N2O10S2/c1-11(2)20(28)12-3-4-13(18(9-12)35-10-27)19-14-5-7-16(25)23(37(29,30)31)21(14)36-22-15(19)6-8-17(26)24(22)38(32,33)34/h3-11,25H,26H2,1-2H3,(H,29,30,31)(H,32,33,34)/p+1 |
| InChIKey | QNSYOOGXOALDGU-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 216.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|