C24H22N3O10S2+ — CID 102227067
[6-amino-9-[2-(3-carboxypropylcarbamoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium (PubChem CID 102227067) has the molecular formula C24H22N3O10S2+ and a molecular weight of 576.59 g/mol. Its IUPAC name is [6-amino-9-[2-(3-carboxypropylcarbamoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium.
| Compound Name | [6-amino-9-[2-(3-carboxypropylcarbamoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 102227067 |
| Molecular Formula | C24H22N3O10S2+ |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | [6-amino-9-[2-(3-carboxypropylcarbamoyl)phenyl]-4,5-disulfoxanthen-3-ylidene]azanium |
| SMILES | Nc1ccc2c(-c3ccccc3C(=O)NCCCC(=O)O)c3ccc(=[NH2+])c(S(=O)(=O)O)c-3oc2c1S(=O)(=O)O |
| InChI | InChI=1S/C24H21N3O10S2/c25-16-9-7-14-19(12-4-1-2-5-13(12)24(30)27-11-3-6-18(28)29)15-8-10-17(26)23(39(34,35)36)21(15)37-20(14)22(16)38(31,32)33/h1-2,4-5,7-10,25H,3,6,11,26H2,(H,27,30)(H,28,29)(H,31,32,33)(H,34,35,36)/p+1 |
| InChIKey | HUMMEVXPKKHLDF-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 239.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|