C19H13N2O7S2- — CID 58978855
3-amino-6-azaniumylidene-9-phenylxanthene-4,5-disulfonate (PubChem CID 58978855) has the molecular formula C19H13N2O7S2- and a molecular weight of 445.45 g/mol. Its IUPAC name is 3-amino-6-azaniumylidene-9-phenylxanthene-4,5-disulfonate.
| Compound Name | 3-amino-6-azaniumylidene-9-phenylxanthene-4,5-disulfonate |
|---|---|
| PubChem CID | 58978855 |
| Molecular Formula | C19H13N2O7S2- |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 3-amino-6-azaniumylidene-9-phenylxanthene-4,5-disulfonate |
| SMILES | Nc1ccc2c(-c3ccccc3)c3ccc(=[NH2+])c(S(=O)(=O)[O-])c-3oc2c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C19H14N2O7S2/c20-13-8-6-11-15(10-4-2-1-3-5-10)12-7-9-14(21)19(30(25,26)27)17(12)28-16(11)18(13)29(22,23)24/h1-9,20H,21H2,(H,22,23,24)(H,25,26,27)/p-1 |
| InChIKey | QCWNZWCWMWZRBD-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 179.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|