C24H20N2O10S2 — CID 129238966
5-(ethylcarbamoyl)-2-(3-imino-6-methyl-4,5-disulfoxanthen-9-yl)benzoic acid (PubChem CID 129238966) has the molecular formula C24H20N2O10S2 and a molecular weight of 560.56 g/mol. Its IUPAC name is 5-(ethylcarbamoyl)-2-(3-imino-6-methyl-4,5-disulfoxanthen-9-yl)benzoic acid.
| Compound Name | 5-(ethylcarbamoyl)-2-(3-imino-6-methyl-4,5-disulfoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 129238966 |
| Molecular Formula | C24H20N2O10S2 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | 5-(ethylcarbamoyl)-2-(3-imino-6-methyl-4,5-disulfoxanthen-9-yl)benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)NCC)cc3C(=O)O)c3ccc(C)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C24H20N2O10S2/c1-3-26-23(27)12-5-7-13(16(10-12)24(28)29)18-14-6-4-11(2)21(37(30,31)32)19(14)36-20-15(18)8-9-17(25)22(20)38(33,34)35/h4-10,25H,3H2,1-2H3,(H,26,27)(H,28,29)(H,30,31,32)(H,33,34,35)/b25-17+ |
| InChIKey | MYTJLRICYUDJON-KOEQRZSOSA-N |
| XLogP | 2.93 |
| TPSA | 212.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|