C26H22N4O12S2 — CID 159847875
2-(3-amino-6-imino-4-sulfamoyl-5-sulfoxanthen-9-yl)benzoic acid;(2,5-dioxopyrrolidin-1-yl) acetate (PubChem CID 159847875) has the molecular formula C26H22N4O12S2 and a molecular weight of 646.61 g/mol. Its IUPAC name is 2-(3-amino-6-imino-4-sulfamoyl-5-sulfoxanthen-9-yl)benzoic acid;(2,5-dioxopyrrolidin-1-yl) acetate.
| Compound Name | 2-(3-amino-6-imino-4-sulfamoyl-5-sulfoxanthen-9-yl)benzoic acid;(2,5-dioxopyrrolidin-1-yl) acetate |
|---|---|
| PubChem CID | 159847875 |
| Molecular Formula | C26H22N4O12S2 |
| Molecular Weight | 646.61 g/mol |
| Exact Mass | 646.07 |
| IUPAC Name | 2-(3-amino-6-imino-4-sulfamoyl-5-sulfoxanthen-9-yl)benzoic acid;(2,5-dioxopyrrolidin-1-yl) acetate |
| SMILES | CC(=O)ON1C(=O)CCC1=O.[H]/N=c1\ccc2c(-c3ccccc3C(=O)O)c3ccc(N)c(S(N)(=O)=O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C20H15N3O8S2.C6H7NO4/c21-13-7-5-11-15(9-3-1-2-4-10(9)20(24)25)12-6-8-14(22)19(33(28,29)30)17(12)31-16(11)18(13)32(23,26)27;1-4(8)11-7-5(9)2-3-6(7)10/h1-8,22H,21H2,(H,24,25)(H2,23,26,27)(H,28,29,30);2-3H2,1H3/b22-14+; |
| InChIKey | NPNVCZHOOXVZLX-CWUUNJJBSA-N |
| XLogP | 1.47 |
| TPSA | 278.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.61 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|