C33H25Cl2N3O15S3 — CID 25230042
2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-6-[4-(2,6-dichloro-4-sulfophenoxy)carbonylpiperidine-1-carbonyl]benzoic acid (PubChem CID 25230042) has the molecular formula C33H25Cl2N3O15S3 and a molecular weight of 870.68 g/mol. Its IUPAC name is 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-6-[4-(2,6-dichloro-4-sulfophenoxy)carbonylpiperidine-1-carbonyl]benzoic acid.
| Compound Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-6-[4-(2,6-dichloro-4-sulfophenoxy)carbonylpiperidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 25230042 |
| Molecular Formula | C33H25Cl2N3O15S3 |
| Molecular Weight | 870.68 g/mol |
| Exact Mass | 868.98 |
| IUPAC Name | 2-(3-amino-6-imino-4,5-disulfoxanthen-9-yl)-6-[4-(2,6-dichloro-4-sulfophenoxy)carbonylpiperidine-1-carbonyl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3cccc(C(=O)N4CCC(C(=O)Oc5c(Cl)cc(S(=O)(=O)O)cc5Cl)CC4)c3C(=O)O)c3ccc(N)c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O |
| InChI | InChI=1S/C33H25Cl2N3O15S3/c34-20-12-15(54(43,44)45)13-21(35)28(20)53-33(42)14-8-10-38(11-9-14)31(39)19-3-1-2-16(25(19)32(40)41)24-17-4-6-22(36)29(55(46,47)48)26(17)52-27-18(24)5-7-23(37)30(27)56(49,50)51/h1-7,12-14,36H,8-11,37H2,(H,40,41)(H,43,44,45)(H,46,47,48)(H,49,50,51)/b36-22+ |
| InChIKey | BXCIIENUNWSQSM-HPNXWYHWSA-N |
| XLogP | 4.47 |
| TPSA | 310.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|