C51H37N3O7 — CID 157252474
methyl 2-(10-amino-1-iminobenzo[c]xanthen-7-yl)benzoate;methyl 2-(10-imino-1-methoxybenzo[c]xanthen-7-yl)benzoate (PubChem CID 157252474) has the molecular formula C51H37N3O7 and a molecular weight of 803.87 g/mol. Its IUPAC name is methyl 2-(10-amino-1-iminobenzo[c]xanthen-7-yl)benzoate;methyl 2-(10-imino-1-methoxybenzo[c]xanthen-7-yl)benzoate.
| Compound Name | methyl 2-(10-amino-1-iminobenzo[c]xanthen-7-yl)benzoate;methyl 2-(10-imino-1-methoxybenzo[c]xanthen-7-yl)benzoate |
|---|---|
| PubChem CID | 157252474 |
| Molecular Formula | C51H37N3O7 |
| Molecular Weight | 803.87 g/mol |
| Exact Mass | 803.26 |
| IUPAC Name | methyl 2-(10-amino-1-iminobenzo[c]xanthen-7-yl)benzoate;methyl 2-(10-imino-1-methoxybenzo[c]xanthen-7-yl)benzoate |
| SMILES | [H]/N=c1\ccc2c(-c3ccccc3C(=O)OC)c3ccc4cccc(OC)c4c3oc-2c1.[H]/N=c1\cccc2ccc3c(-c4ccccc4C(=O)OC)c4ccc(N)cc4oc3c12 |
| InChI | InChI=1S/C26H19NO4.C25H18N2O3/c1-29-21-9-5-6-15-10-12-20-24(17-7-3-4-8-18(17)26(28)30-2)19-13-11-16(27)14-22(19)31-25(20)23(15)21;1-29-25(28)17-7-3-2-6-16(17)23-18-12-10-15(26)13-21(18)30-24-19(23)11-9-14-5-4-8-20(27)22(14)24/h3-14,27H,1-2H3;2-13,27H,26H2,1H3/b27-16+;27-20+ |
| InChIKey | YKZCKOLIPVQJOO-BAEPGAHASA-N |
| XLogP | 10.89 |
| TPSA | 161.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.87 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|