C42H37N5O15S — CID 173479267
2-[3-amino-4-[[4-[bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]phenyl]sulfamoyl]-6-iminoxanthen-9-yl]benzoic acid (PubChem CID 173479267) has the molecular formula C42H37N5O15S and a molecular weight of 883.84 g/mol. Its IUPAC name is 2-[3-amino-4-[[4-[bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]phenyl]sulfamoyl]-6-iminoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-amino-4-[[4-[bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]phenyl]sulfamoyl]-6-iminoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 173479267 |
| Molecular Formula | C42H37N5O15S |
| Molecular Weight | 883.84 g/mol |
| Exact Mass | 883.20 |
| IUPAC Name | 2-[3-amino-4-[[4-[bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]phenyl]sulfamoyl]-6-iminoxanthen-9-yl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccccc3C(=O)O)c3ccc(N)c(S(=O)(=O)Nc4ccc(N(CC(=O)O)CC(=O)O)c(OCCOc5ccccc5N(CC(=O)O)CC(=O)O)c4)c3oc-2c1 |
| InChI | InChI=1S/C42H37N5O15S/c43-23-9-11-27-33(17-23)62-40-28(39(27)25-5-1-2-6-26(25)42(56)57)12-13-29(44)41(40)63(58,59)45-24-10-14-31(47(21-37(52)53)22-38(54)55)34(18-24)61-16-15-60-32-8-4-3-7-30(32)46(19-35(48)49)20-36(50)51/h1-14,17-18,43,45H,15-16,19-22,44H2,(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H,56,57)/b43-23+ |
| InChIKey | CUEFURSJMINNJS-MODVXTFTSA-N |
| XLogP | 4.17 |
| TPSA | 320.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|