C30H24N4O10S — CID 173479720
2-[3-amino-4-[[4-[bis(carboxymethyl)amino]-3-hydroxyphenyl]sulfamoyl]-6-iminoxanthen-9-yl]benzoic acid (PubChem CID 173479720) has the molecular formula C30H24N4O10S and a molecular weight of 632.61 g/mol. Its IUPAC name is 2-[3-amino-4-[[4-[bis(carboxymethyl)amino]-3-hydroxyphenyl]sulfamoyl]-6-iminoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-amino-4-[[4-[bis(carboxymethyl)amino]-3-hydroxyphenyl]sulfamoyl]-6-iminoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 173479720 |
| Molecular Formula | C30H24N4O10S |
| Molecular Weight | 632.61 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | 2-[3-amino-4-[[4-[bis(carboxymethyl)amino]-3-hydroxyphenyl]sulfamoyl]-6-iminoxanthen-9-yl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccccc3C(=O)O)c3ccc(N)c(S(=O)(=O)Nc4ccc(N(CC(=O)O)CC(=O)O)c(O)c4)c3oc-2c1 |
| InChI | InChI=1S/C30H24N4O10S/c31-15-5-7-19-24(11-15)44-28-20(27(19)17-3-1-2-4-18(17)30(40)41)8-9-21(32)29(28)45(42,43)33-16-6-10-22(23(35)12-16)34(13-25(36)37)14-26(38)39/h1-12,31,33,35H,13-14,32H2,(H,36,37)(H,38,39)(H,40,41)/b31-15+ |
| InChIKey | GGHQQDKQNSXJRT-IBBHUPRXSA-N |
| XLogP | 3.45 |
| TPSA | 244.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|