C23H20N2O3 — CID 130353463
2-(3-amino-6-iminoxanthen-9-yl)-5-propan-2-ylbenzoic acid (PubChem CID 130353463) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-(3-amino-6-iminoxanthen-9-yl)-5-propan-2-ylbenzoic acid.
| Compound Name | 2-(3-amino-6-iminoxanthen-9-yl)-5-propan-2-ylbenzoic acid |
|---|---|
| PubChem CID | 130353463 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-(3-amino-6-iminoxanthen-9-yl)-5-propan-2-ylbenzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(C)C)cc3C(=O)O)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C23H20N2O3/c1-12(2)13-3-6-16(19(9-13)23(26)27)22-17-7-4-14(24)10-20(17)28-21-11-15(25)5-8-18(21)22/h3-12,24H,25H2,1-2H3,(H,26,27)/b24-14+ |
| InChIKey | OBDHGYRZEPWWTQ-ZVHZXABRSA-N |
| XLogP | 5.09 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|