C27H19N3O9 — CID 160884186
2-(3-amino-6-iminoxanthen-9-yl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyacetyl]benzoic acid (PubChem CID 160884186) has the molecular formula C27H19N3O9 and a molecular weight of 529.46 g/mol. Its IUPAC name is 2-(3-amino-6-iminoxanthen-9-yl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyacetyl]benzoic acid.
| Compound Name | 2-(3-amino-6-iminoxanthen-9-yl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyacetyl]benzoic acid |
|---|---|
| PubChem CID | 160884186 |
| Molecular Formula | C27H19N3O9 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 2-(3-amino-6-iminoxanthen-9-yl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyacetyl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)COC(=O)ON4C(=O)CCC4=O)cc3C(=O)O)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C27H19N3O9/c28-14-2-5-17-21(10-14)38-22-11-15(29)3-6-18(22)25(17)16-4-1-13(9-19(16)26(34)35)20(31)12-37-27(36)39-30-23(32)7-8-24(30)33/h1-6,9-11,28H,7-8,12,29H2,(H,34,35)/b28-14+ |
| InChIKey | SNKNUUQUUVDZMN-CCVNUDIWSA-N |
| XLogP | 3.36 |
| TPSA | 190.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|