C25H22N2O4 — CID 166713132
2-(3-amino-6-iminoxanthen-9-yl)-4-(3-methyl-2-oxobutyl)benzoic acid (PubChem CID 166713132) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-(3-amino-6-iminoxanthen-9-yl)-4-(3-methyl-2-oxobutyl)benzoic acid.
| Compound Name | 2-(3-amino-6-iminoxanthen-9-yl)-4-(3-methyl-2-oxobutyl)benzoic acid |
|---|---|
| PubChem CID | 166713132 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-(3-amino-6-iminoxanthen-9-yl)-4-(3-methyl-2-oxobutyl)benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3cc(CC(=O)C(C)C)ccc3C(=O)O)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C25H22N2O4/c1-13(2)21(28)10-14-3-6-17(25(29)30)20(9-14)24-18-7-4-15(26)11-22(18)31-23-12-16(27)5-8-19(23)24/h3-9,11-13,26H,10,27H2,1-2H3,(H,29,30)/b26-15+ |
| InChIKey | GKUXOTNZVNBLLY-CVKSISIWSA-N |
| XLogP | 4.73 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|