C33H32N6O4 — CID 139488824
2-(3-amino-6-iminoxanthen-9-yl)-N-[2-oxo-2-[[4-(propylaminocarbamoyl)phenyl]methylamino]ethyl]benzamide (PubChem CID 139488824) has the molecular formula C33H32N6O4 and a molecular weight of 576.66 g/mol. Its IUPAC name is 2-(3-amino-6-iminoxanthen-9-yl)-N-[2-oxo-2-[[4-(propylaminocarbamoyl)phenyl]methylamino]ethyl]benzamide.
| Compound Name | 2-(3-amino-6-iminoxanthen-9-yl)-N-[2-oxo-2-[[4-(propylaminocarbamoyl)phenyl]methylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 139488824 |
| Molecular Formula | C33H32N6O4 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 2-(3-amino-6-iminoxanthen-9-yl)-N-[2-oxo-2-[[4-(propylaminocarbamoyl)phenyl]methylamino]ethyl]benzamide |
| SMILES | [H]/N=c1\ccc2c(-c3ccccc3C(=O)NCC(=O)NCc3ccc(C(=O)NNCCC)cc3)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C33H32N6O4/c1-2-15-38-39-32(41)21-9-7-20(8-10-21)18-36-30(40)19-37-33(42)25-6-4-3-5-24(25)31-26-13-11-22(34)16-28(26)43-29-17-23(35)12-14-27(29)31/h3-14,16-17,34,38H,2,15,18-19,35H2,1H3,(H,36,40)(H,37,42)(H,39,41)/b34-22+ |
| InChIKey | DMUZVKDUQWEUPF-PPOKSSTKSA-N |
| XLogP | 3.96 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|