C20H14N2O3 — CID 23758006
9-(1,3-benzodioxol-5-yl)-6-iminoxanthen-3-amine (PubChem CID 23758006) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-6-iminoxanthen-3-amine.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-6-iminoxanthen-3-amine |
|---|---|
| PubChem CID | 23758006 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-6-iminoxanthen-3-amine |
| SMILES | [H]/N=c1\ccc2c(-c3ccc4c(c3)OCO4)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C20H14N2O3/c21-12-2-4-14-17(8-12)25-18-9-13(22)3-5-15(18)20(14)11-1-6-16-19(7-11)24-10-23-16/h1-9,21H,10,22H2/b21-12+ |
| InChIKey | GCRDLXBGJHAQMX-CIAFOILYSA-N |
| XLogP | 3.99 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|