C25H23FN2O2 — CID 23758704
9-(3-fluoro-4-methoxyphenyl)-6-piperidin-1-ylxanthen-3-imine (PubChem CID 23758704) has the molecular formula C25H23FN2O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is 9-(3-fluoro-4-methoxyphenyl)-6-piperidin-1-ylxanthen-3-imine.
| Compound Name | 9-(3-fluoro-4-methoxyphenyl)-6-piperidin-1-ylxanthen-3-imine |
|---|---|
| PubChem CID | 23758704 |
| Molecular Formula | C25H23FN2O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 9-(3-fluoro-4-methoxyphenyl)-6-piperidin-1-ylxanthen-3-imine |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(OC)c(F)c3)c3ccc(N4CCCCC4)cc3oc-2c1 |
| InChI | InChI=1S/C25H23FN2O2/c1-29-22-10-5-16(13-21(22)26)25-19-8-6-17(27)14-23(19)30-24-15-18(7-9-20(24)25)28-11-3-2-4-12-28/h5-10,13-15,27H,2-4,11-12H2,1H3/b27-17+ |
| InChIKey | ZYTHZJCYXRESCG-WPWMEQJKSA-N |
| XLogP | 5.82 |
| TPSA | 49.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|