C23H22N2O3 — CID 23845251
9-(3,4-dimethoxyphenyl)-6-imino-N,N-dimethylxanthen-3-amine (PubChem CID 23845251) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-6-imino-N,N-dimethylxanthen-3-amine.
| Compound Name | 9-(3,4-dimethoxyphenyl)-6-imino-N,N-dimethylxanthen-3-amine |
|---|---|
| PubChem CID | 23845251 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-6-imino-N,N-dimethylxanthen-3-amine |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(OC)c(OC)c3)c3ccc(N(C)C)cc3oc-2c1 |
| InChI | InChI=1S/C23H22N2O3/c1-25(2)16-7-9-18-21(13-16)28-20-12-15(24)6-8-17(20)23(18)14-5-10-19(26-3)22(11-14)27-4/h5-13,24H,1-4H3/b24-15+ |
| InChIKey | ZMNRGJCHGFGDKH-BUVRLJJBSA-N |
| XLogP | 4.77 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|