C31H38N4O2 — CID 23787805
N'-ethyl-N'-[6-imino-9-[3-(morpholin-4-ylmethyl)phenyl]xanthen-3-yl]-N,N-dimethylpropane-1,3-diamine (PubChem CID 23787805) has the molecular formula C31H38N4O2 and a molecular weight of 498.67 g/mol. Its IUPAC name is N'-ethyl-N'-[6-imino-9-[3-(morpholin-4-ylmethyl)phenyl]xanthen-3-yl]-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-ethyl-N'-[6-imino-9-[3-(morpholin-4-ylmethyl)phenyl]xanthen-3-yl]-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 23787805 |
| Molecular Formula | C31H38N4O2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | N'-ethyl-N'-[6-imino-9-[3-(morpholin-4-ylmethyl)phenyl]xanthen-3-yl]-N,N-dimethylpropane-1,3-diamine |
| SMILES | [H]/N=c1\ccc2c(-c3cccc(CN4CCOCC4)c3)c3ccc(N(CC)CCCN(C)C)cc3oc-2c1 |
| InChI | InChI=1S/C31H38N4O2/c1-4-35(14-6-13-33(2)3)26-10-12-28-30(21-26)37-29-20-25(32)9-11-27(29)31(28)24-8-5-7-23(19-24)22-34-15-17-36-18-16-34/h5,7-12,19-21,32H,4,6,13-18,22H2,1-3H3/b32-25+ |
| InChIKey | XZUJRLSRMQVBOV-WGPBWIAQSA-N |
| XLogP | 5.29 |
| TPSA | 55.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|