C27H29FN2O — CID 23758759
N,N-dibutyl-9-(4-fluorophenyl)-6-iminoxanthen-3-amine (PubChem CID 23758759) has the molecular formula C27H29FN2O and a molecular weight of 416.54 g/mol. Its IUPAC name is N,N-dibutyl-9-(4-fluorophenyl)-6-iminoxanthen-3-amine.
| Compound Name | N,N-dibutyl-9-(4-fluorophenyl)-6-iminoxanthen-3-amine |
|---|---|
| PubChem CID | 23758759 |
| Molecular Formula | C27H29FN2O |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N,N-dibutyl-9-(4-fluorophenyl)-6-iminoxanthen-3-amine |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(F)cc3)c3ccc(N(CCCC)CCCC)cc3oc-2c1 |
| InChI | InChI=1S/C27H29FN2O/c1-3-5-15-30(16-6-4-2)22-12-14-24-26(18-22)31-25-17-21(29)11-13-23(25)27(24)19-7-9-20(28)10-8-19/h7-14,17-18,29H,3-6,15-16H2,1-2H3/b29-21+ |
| InChIKey | FTGMILZLOAUGKU-XHLNEMQHSA-N |
| XLogP | 7.23 |
| TPSA | 40.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|