C25H22F5N2O+ — CID 89232577
[6-(diethylamino)-9-(2,3,4,5,6-pentafluorophenyl)xanthen-3-ylidene]-dimethylazanium (PubChem CID 89232577) has the molecular formula C25H22F5N2O+ and a molecular weight of 461.45 g/mol. Its IUPAC name is [6-(diethylamino)-9-(2,3,4,5,6-pentafluorophenyl)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [6-(diethylamino)-9-(2,3,4,5,6-pentafluorophenyl)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 89232577 |
| Molecular Formula | C25H22F5N2O+ |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [6-(diethylamino)-9-(2,3,4,5,6-pentafluorophenyl)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3c(F)c(F)c(F)c(F)c3F)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C25H22F5N2O/c1-5-32(6-2)14-8-10-16-18(12-14)33-17-11-13(31(3)4)7-9-15(17)19(16)20-21(26)23(28)25(30)24(29)22(20)27/h7-12H,5-6H2,1-4H3/q+1 |
| InChIKey | HDNHKFZYTPRYGN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 19.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|