C31H34N2O6S — CID 163704919
3-[[3-[3-(diethylamino)-6-oxoxanthen-9-yl]phenyl]methylsulfonylamino]propyl 2-methylprop-2-enoate (PubChem CID 163704919) has the molecular formula C31H34N2O6S and a molecular weight of 562.69 g/mol. Its IUPAC name is 3-[[3-[3-(diethylamino)-6-oxoxanthen-9-yl]phenyl]methylsulfonylamino]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[3-[3-(diethylamino)-6-oxoxanthen-9-yl]phenyl]methylsulfonylamino]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163704919 |
| Molecular Formula | C31H34N2O6S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 3-[[3-[3-(diethylamino)-6-oxoxanthen-9-yl]phenyl]methylsulfonylamino]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCNS(=O)(=O)Cc1cccc(-c2c3ccc(=O)cc-3oc3cc(N(CC)CC)ccc23)c1 |
| InChI | InChI=1S/C31H34N2O6S/c1-5-33(6-2)24-11-13-26-28(18-24)39-29-19-25(34)12-14-27(29)30(26)23-10-7-9-22(17-23)20-40(36,37)32-15-8-16-38-31(35)21(3)4/h7,9-14,17-19,32H,3,5-6,8,15-16,20H2,1-2,4H3 |
| InChIKey | KEFWVCIDEPIGFR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|