C27H27N2O2+ — CID 145053886
1-[2-[3-(aziridin-1-ium-1-ylidene)-6-(diethylamino)xanthen-9-yl]phenyl]ethanone (PubChem CID 145053886) has the molecular formula C27H27N2O2+ and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-[2-[3-(aziridin-1-ium-1-ylidene)-6-(diethylamino)xanthen-9-yl]phenyl]ethanone.
| Compound Name | 1-[2-[3-(aziridin-1-ium-1-ylidene)-6-(diethylamino)xanthen-9-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 145053886 |
| Molecular Formula | C27H27N2O2+ |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-[2-[3-(aziridin-1-ium-1-ylidene)-6-(diethylamino)xanthen-9-yl]phenyl]ethanone |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(C)=O)c3ccc(=[N+]4CC4)cc-3oc2c1 |
| InChI | InChI=1S/C27H27N2O2/c1-4-28(5-2)19-10-12-23-25(16-19)31-26-17-20(29-14-15-29)11-13-24(26)27(23)22-9-7-6-8-21(22)18(3)30/h6-13,16-17H,4-5,14-15H2,1-3H3/q+1 |
| InChIKey | BMNUYKHDVVGAIQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 36.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|