C28H32N2O3 — CID 142832415
2-[3-(diethylamino)-6-ethyliminoxanthen-9-yl]benzoic acid;ethane (PubChem CID 142832415) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[3-(diethylamino)-6-ethyliminoxanthen-9-yl]benzoic acid;ethane.
| Compound Name | 2-[3-(diethylamino)-6-ethyliminoxanthen-9-yl]benzoic acid;ethane |
|---|---|
| PubChem CID | 142832415 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 2-[3-(diethylamino)-6-ethyliminoxanthen-9-yl]benzoic acid;ethane |
| SMILES | CC.CC/N=c1\ccc2c(-c3ccccc3C(=O)O)c3ccc(N(CC)CC)cc3oc-2c1 |
| InChI | InChI=1S/C26H26N2O3.C2H6/c1-4-27-17-11-13-21-23(15-17)31-24-16-18(28(5-2)6-3)12-14-22(24)25(21)19-9-7-8-10-20(19)26(29)30;1-2/h7-16H,4-6H2,1-3H3,(H,29,30);1-2H3/b27-17+; |
| InChIKey | PYLYFMZZEFVLNC-ZKDABKAQSA-N |
| XLogP | 6.70 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|