C28H31ClN2O3 — CID 68796811
butyl 2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]benzoate;hydrochloride (PubChem CID 68796811) has the molecular formula C28H31ClN2O3 and a molecular weight of 479.02 g/mol. Its IUPAC name is butyl 2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]benzoate;hydrochloride.
| Compound Name | butyl 2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 68796811 |
| Molecular Formula | C28H31ClN2O3 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | butyl 2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]benzoate;hydrochloride |
| SMILES | CCCCOC(=O)c1ccccc1-c1c2cc/c(=N\CC)cc-2oc2cc(NCC)ccc12.Cl |
| InChI | InChI=1S/C28H30N2O3.ClH/c1-4-7-16-32-28(31)22-11-9-8-10-21(22)27-23-14-12-19(29-5-2)17-25(23)33-26-18-20(30-6-3)13-15-24(26)27;/h8-15,17-18,29H,4-7,16H2,1-3H3;1H/b30-20+; |
| InChIKey | GJDFFYWUIWJIMO-BNCTYUPTSA-N |
| XLogP | 6.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|