C34H29F4N3O3S3 — CID 144937602
2-[4-[[2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]phenyl]sulfanylamino]sulfanyl-2,3,5,6-tetrafluorophenyl]sulfanylethyl prop-2-enoate (PubChem CID 144937602) has the molecular formula C34H29F4N3O3S3 and a molecular weight of 699.82 g/mol. Its IUPAC name is 2-[4-[[2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]phenyl]sulfanylamino]sulfanyl-2,3,5,6-tetrafluorophenyl]sulfanylethyl prop-2-enoate.
| Compound Name | 2-[4-[[2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]phenyl]sulfanylamino]sulfanyl-2,3,5,6-tetrafluorophenyl]sulfanylethyl prop-2-enoate |
|---|---|
| PubChem CID | 144937602 |
| Molecular Formula | C34H29F4N3O3S3 |
| Molecular Weight | 699.82 g/mol |
| Exact Mass | 699.13 |
| IUPAC Name | 2-[4-[[2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]phenyl]sulfanylamino]sulfanyl-2,3,5,6-tetrafluorophenyl]sulfanylethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCSc1c(F)c(F)c(SNSc2ccccc2-c2c3cc/c(=N\CC)cc-3oc3cc(NCC)ccc23)c(F)c1F |
| InChI | InChI=1S/C34H29F4N3O3S3/c1-4-27(42)43-15-16-45-33-29(35)31(37)34(32(38)30(33)36)47-41-46-26-10-8-7-9-23(26)28-21-13-11-19(39-5-2)17-24(21)44-25-18-20(40-6-3)12-14-22(25)28/h4,7-14,17-18,39,41H,1,5-6,15-16H2,2-3H3/b40-20+ |
| InChIKey | XIINLDAVZWQIJC-KPRPFPDJSA-N |
| XLogP | 9.24 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.82 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|