C48H46N4O9Si — CID 139595415
bis([9-(2-carboxyphenyl)-6-(ethylamino)xanthen-3-ylidene]-ethylazanium);dioxido(oxo)silane (PubChem CID 139595415) has the molecular formula C48H46N4O9Si and a molecular weight of 851.00 g/mol. Its IUPAC name is bis([9-(2-carboxyphenyl)-6-(ethylamino)xanthen-3-ylidene]-ethylazanium);dioxido(oxo)silane.
| Compound Name | bis([9-(2-carboxyphenyl)-6-(ethylamino)xanthen-3-ylidene]-ethylazanium);dioxido(oxo)silane |
|---|---|
| PubChem CID | 139595415 |
| Molecular Formula | C48H46N4O9Si |
| Molecular Weight | 851.00 g/mol |
| Exact Mass | 850.30 |
| IUPAC Name | bis([9-(2-carboxyphenyl)-6-(ethylamino)xanthen-3-ylidene]-ethylazanium);dioxido(oxo)silane |
| SMILES | CCNc1ccc2c(-c3ccccc3C(=O)O)c3cc/c(=[NH+]\CC)cc-3oc2c1.CCNc1ccc2c(-c3ccccc3C(=O)O)c3cc/c(=[NH+]\CC)cc-3oc2c1.O=[Si]([O-])[O-] |
| InChI | InChI=1S/2C24H22N2O3.O3Si/c2*1-3-25-15-9-11-19-21(13-15)29-22-14-16(26-4-2)10-12-20(22)23(19)17-7-5-6-8-18(17)24(27)28;1-4(2)3/h2*5-14,25H,3-4H2,1-2H3,(H,27,28);/q;;-2/p+2/b2*26-16+; |
| InChIKey | VKPVASKJRRBDQC-STTQXTIPSA-P |
| XLogP | 3.79 |
| TPSA | 216.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|