C39H38N4O3 — CID 135611673
2-[3-[4-(diethylamino)anilino]-6-[4-[ethyl(methyl)amino]phenyl]azaniumylidenexanthen-9-yl]benzoate (PubChem CID 135611673) has the molecular formula C39H38N4O3 and a molecular weight of 610.76 g/mol. Its IUPAC name is 2-[3-[4-(diethylamino)anilino]-6-[4-[ethyl(methyl)amino]phenyl]azaniumylidenexanthen-9-yl]benzoate.
| Compound Name | 2-[3-[4-(diethylamino)anilino]-6-[4-[ethyl(methyl)amino]phenyl]azaniumylidenexanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 135611673 |
| Molecular Formula | C39H38N4O3 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | 2-[3-[4-(diethylamino)anilino]-6-[4-[ethyl(methyl)amino]phenyl]azaniumylidenexanthen-9-yl]benzoate |
| SMILES | CCN(C)c1ccc(/[NH+]=c2\ccc3c(-c4ccccc4C(=O)[O-])c4ccc(Nc5ccc(N(CC)CC)cc5)cc4oc-3c2)cc1 |
| InChI | InChI=1S/C39H38N4O3/c1-5-42(4)30-18-12-26(13-19-30)40-28-16-22-34-36(24-28)46-37-25-29(41-27-14-20-31(21-15-27)43(6-2)7-3)17-23-35(37)38(34)32-10-8-9-11-33(32)39(44)45/h8-25,41H,5-7H2,1-4H3,(H,44,45)/b40-28+ |
| InChIKey | CYTGLTMWYSMQSL-JFXHSDHMSA-N |
| XLogP | 5.93 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|