C36H32N4O3 — CID 135476618
2-[3,6-bis[4-(dimethylamino)anilino]xanthen-10-ium-9-yl]benzoate (PubChem CID 135476618) has the molecular formula C36H32N4O3 and a molecular weight of 568.68 g/mol. Its IUPAC name is 2-[3,6-bis[4-(dimethylamino)anilino]xanthen-10-ium-9-yl]benzoate.
| Compound Name | 2-[3,6-bis[4-(dimethylamino)anilino]xanthen-10-ium-9-yl]benzoate |
|---|---|
| PubChem CID | 135476618 |
| Molecular Formula | C36H32N4O3 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 2-[3,6-bis[4-(dimethylamino)anilino]xanthen-10-ium-9-yl]benzoate |
| SMILES | CN(C)c1ccc(Nc2ccc3c(-c4ccccc4C(=O)[O-])c4ccc(Nc5ccc(N(C)C)cc5)cc4[o+]c3c2)cc1 |
| InChI | InChI=1S/C36H32N4O3/c1-39(2)27-15-9-23(10-16-27)37-25-13-19-31-33(21-25)43-34-22-26(38-24-11-17-28(18-12-24)40(3)4)14-20-32(34)35(31)29-7-5-6-8-30(29)36(41)42/h5-22,37-38H,1-4H3 |
| InChIKey | CQQOKQARGRZPCU-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 81.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|