C19H17ClN3O2- — CID 2241668
7-chloro-4-[4-(dimethylamino)anilino]-8-methylquinoline-3-carboxylate (PubChem CID 2241668) has the molecular formula C19H17ClN3O2- and a molecular weight of 354.82 g/mol. Its IUPAC name is 7-chloro-4-[4-(dimethylamino)anilino]-8-methylquinoline-3-carboxylate.
| Compound Name | 7-chloro-4-[4-(dimethylamino)anilino]-8-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2241668 |
| Molecular Formula | C19H17ClN3O2- |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 7-chloro-4-[4-(dimethylamino)anilino]-8-methylquinoline-3-carboxylate |
| SMILES | Cc1c(Cl)ccc2c(Nc3ccc(N(C)C)cc3)c(C(=O)[O-])cnc12 |
| InChI | InChI=1S/C19H18ClN3O2/c1-11-16(20)9-8-14-17(11)21-10-15(19(24)25)18(14)22-12-4-6-13(7-5-12)23(2)3/h4-10H,1-3H3,(H,21,22)(H,24,25)/p-1 |
| InChIKey | WGGLDFMZAQKPKT-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|