C19H16ClN2O2- — CID 2241646
7-chloro-4-(2-ethylanilino)-8-methylquinoline-3-carboxylate (PubChem CID 2241646) has the molecular formula C19H16ClN2O2- and a molecular weight of 339.80 g/mol. Its IUPAC name is 7-chloro-4-(2-ethylanilino)-8-methylquinoline-3-carboxylate.
| Compound Name | 7-chloro-4-(2-ethylanilino)-8-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2241646 |
| Molecular Formula | C19H16ClN2O2- |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 7-chloro-4-(2-ethylanilino)-8-methylquinoline-3-carboxylate |
| SMILES | CCc1ccccc1Nc1c(C(=O)[O-])cnc2c(C)c(Cl)ccc12 |
| InChI | InChI=1S/C19H17ClN2O2/c1-3-12-6-4-5-7-16(12)22-18-13-8-9-15(20)11(2)17(13)21-10-14(18)19(23)24/h4-10H,3H2,1-2H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | PYVWMESSDOGGCU-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |