C17H13N2O2- — CID 19759621
4-(2-methylanilino)quinoline-3-carboxylate (PubChem CID 19759621) has the molecular formula C17H13N2O2- and a molecular weight of 277.30 g/mol. Its IUPAC name is 4-(2-methylanilino)quinoline-3-carboxylate.
| Compound Name | 4-(2-methylanilino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 19759621 |
| Molecular Formula | C17H13N2O2- |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-(2-methylanilino)quinoline-3-carboxylate |
| SMILES | Cc1ccccc1Nc1c(C(=O)[O-])cnc2ccccc12 |
| InChI | InChI=1S/C17H14N2O2/c1-11-6-2-4-8-14(11)19-16-12-7-3-5-9-15(12)18-10-13(16)17(20)21/h2-10H,1H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | SHNZEHDBIHNAGZ-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |