C26H24N2O4 — CID 139661322
ethyl 8-[hydroxy-(4-hydroxyphenyl)methyl]-4-(2-methylanilino)quinoline-3-carboxylate (PubChem CID 139661322) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is ethyl 8-[hydroxy-(4-hydroxyphenyl)methyl]-4-(2-methylanilino)quinoline-3-carboxylate.
| Compound Name | ethyl 8-[hydroxy-(4-hydroxyphenyl)methyl]-4-(2-methylanilino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 139661322 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | ethyl 8-[hydroxy-(4-hydroxyphenyl)methyl]-4-(2-methylanilino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(C(O)c3ccc(O)cc3)cccc2c1Nc1ccccc1C |
| InChI | InChI=1S/C26H24N2O4/c1-3-32-26(31)21-15-27-23-19(24(21)28-22-10-5-4-7-16(22)2)8-6-9-20(23)25(30)17-11-13-18(29)14-12-17/h4-15,25,29-30H,3H2,1-2H3,(H,27,28) |
| InChIKey | NYWMYHKVQHCOSV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |