C28H26N2O3 — CID 19923006
[3-butanoyl-4-(2-methylanilino)quinolin-6-yl]methyl benzoate (PubChem CID 19923006) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is [3-butanoyl-4-(2-methylanilino)quinolin-6-yl]methyl benzoate.
| Compound Name | [3-butanoyl-4-(2-methylanilino)quinolin-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 19923006 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [3-butanoyl-4-(2-methylanilino)quinolin-6-yl]methyl benzoate |
| SMILES | CCCC(=O)c1cnc2ccc(COC(=O)c3ccccc3)cc2c1Nc1ccccc1C |
| InChI | InChI=1S/C28H26N2O3/c1-3-9-26(31)23-17-29-25-15-14-20(18-33-28(32)21-11-5-4-6-12-21)16-22(25)27(23)30-24-13-8-7-10-19(24)2/h4-8,10-17H,3,9,18H2,1-2H3,(H,29,30) |
| InChIKey | GRWQWUNUNJQUIL-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |