C45H46N4O7 — CID 154825435
bis[2-[3-butanoyl-4-(2-methylanilino)quinolin-8-yl]oxyethyl] carbonate (PubChem CID 154825435) has the molecular formula C45H46N4O7 and a molecular weight of 754.88 g/mol. Its IUPAC name is bis[2-[3-butanoyl-4-(2-methylanilino)quinolin-8-yl]oxyethyl] carbonate.
| Compound Name | bis[2-[3-butanoyl-4-(2-methylanilino)quinolin-8-yl]oxyethyl] carbonate |
|---|---|
| PubChem CID | 154825435 |
| Molecular Formula | C45H46N4O7 |
| Molecular Weight | 754.88 g/mol |
| Exact Mass | 754.34 |
| IUPAC Name | bis[2-[3-butanoyl-4-(2-methylanilino)quinolin-8-yl]oxyethyl] carbonate |
| SMILES | CCCC(=O)c1cnc2c(OCCOC(=O)OCCOc3cccc4c(Nc5ccccc5C)c(C(=O)CCC)cnc34)cccc2c1Nc1ccccc1C |
| InChI | InChI=1S/C45H46N4O7/c1-5-13-37(50)33-27-46-43-31(41(33)48-35-19-9-7-15-29(35)3)17-11-21-39(43)53-23-25-55-45(52)56-26-24-54-40-22-12-18-32-42(49-36-20-10-8-16-30(36)4)34(28-47-44(32)40)38(51)14-6-2/h7-12,15-22,27-28H,5-6,13-14,23-26H2,1-4H3,(H,46,48)(H,47,49) |
| InChIKey | NIGICCMEZYTYIH-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.88 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|