C27H32N2O4 — CID 10253105
ethyl 4-[3-butanoyl-4-(2,6-dimethylanilino)quinolin-8-yl]oxybutanoate (PubChem CID 10253105) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is ethyl 4-[3-butanoyl-4-(2,6-dimethylanilino)quinolin-8-yl]oxybutanoate.
| Compound Name | ethyl 4-[3-butanoyl-4-(2,6-dimethylanilino)quinolin-8-yl]oxybutanoate |
|---|---|
| PubChem CID | 10253105 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | ethyl 4-[3-butanoyl-4-(2,6-dimethylanilino)quinolin-8-yl]oxybutanoate |
| SMILES | CCCC(=O)c1cnc2c(OCCCC(=O)OCC)cccc2c1Nc1c(C)cccc1C |
| InChI | InChI=1S/C27H32N2O4/c1-5-10-22(30)21-17-28-27-20(26(21)29-25-18(3)11-7-12-19(25)4)13-8-14-23(27)33-16-9-15-24(31)32-6-2/h7-8,11-14,17H,5-6,9-10,15-16H2,1-4H3,(H,28,29) |
| InChIKey | OAZXFOHJVVDAMG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|