C24H27FN2O4 — CID 10387749
1-[4-(4-fluoro-2-methylanilino)-8-[2-(2-hydroxyethoxy)ethoxy]quinolin-3-yl]butan-1-one (PubChem CID 10387749) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-[4-(4-fluoro-2-methylanilino)-8-[2-(2-hydroxyethoxy)ethoxy]quinolin-3-yl]butan-1-one.
| Compound Name | 1-[4-(4-fluoro-2-methylanilino)-8-[2-(2-hydroxyethoxy)ethoxy]quinolin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 10387749 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-[4-(4-fluoro-2-methylanilino)-8-[2-(2-hydroxyethoxy)ethoxy]quinolin-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1cnc2c(OCCOCCO)cccc2c1Nc1ccc(F)cc1C |
| InChI | InChI=1S/C24H27FN2O4/c1-3-5-21(29)19-15-26-24-18(6-4-7-22(24)31-13-12-30-11-10-28)23(19)27-20-9-8-17(25)14-16(20)2/h4,6-9,14-15,28H,3,5,10-13H2,1-2H3,(H,26,27) |
| InChIKey | XOMOQJRCUFEINN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|