C23H26N2O3 — CID 142628369
1-[8-(1-methoxyethoxy)-4-(2-methylanilino)quinolin-3-yl]butan-1-one (PubChem CID 142628369) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-[8-(1-methoxyethoxy)-4-(2-methylanilino)quinolin-3-yl]butan-1-one.
| Compound Name | 1-[8-(1-methoxyethoxy)-4-(2-methylanilino)quinolin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 142628369 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[8-(1-methoxyethoxy)-4-(2-methylanilino)quinolin-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1cnc2c(OC(C)OC)cccc2c1Nc1ccccc1C |
| InChI | InChI=1S/C23H26N2O3/c1-5-9-20(26)18-14-24-23-17(11-8-13-21(23)28-16(3)27-4)22(18)25-19-12-7-6-10-15(19)2/h6-8,10-14,16H,5,9H2,1-4H3,(H,24,25) |
| InChIKey | CDRBXPWTEUSPOE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|