C25H30N2O2S — CID 54548203
1-[4-(2-methylanilino)-8-(3-propylsulfanylpropoxy)quinolin-3-yl]propan-1-one (PubChem CID 54548203) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is 1-[4-(2-methylanilino)-8-(3-propylsulfanylpropoxy)quinolin-3-yl]propan-1-one.
| Compound Name | 1-[4-(2-methylanilino)-8-(3-propylsulfanylpropoxy)quinolin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 54548203 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-[4-(2-methylanilino)-8-(3-propylsulfanylpropoxy)quinolin-3-yl]propan-1-one |
| SMILES | CCCSCCCOc1cccc2c(Nc3ccccc3C)c(C(=O)CC)cnc12 |
| InChI | InChI=1S/C25H30N2O2S/c1-4-15-30-16-9-14-29-23-13-8-11-19-24(27-21-12-7-6-10-18(21)3)20(22(28)5-2)17-26-25(19)23/h6-8,10-13,17H,4-5,9,14-16H2,1-3H3,(H,26,27) |
| InChIKey | ZIBDGOGZDNRXQL-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|