C23H24N2O3 — CID 10384904
1-[8-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-4-(2-methylanilino)quinolin-3-yl]butan-1-one (PubChem CID 10384904) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[8-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-4-(2-methylanilino)quinolin-3-yl]butan-1-one.
| Compound Name | 1-[8-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-4-(2-methylanilino)quinolin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 10384904 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[8-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-4-(2-methylanilino)quinolin-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1cnc2c([C@@H]3O[C@H]3CO)cccc2c1Nc1ccccc1C |
| InChI | InChI=1S/C23H24N2O3/c1-3-7-19(27)17-12-24-21-15(9-6-10-16(21)23-20(13-26)28-23)22(17)25-18-11-5-4-8-14(18)2/h4-6,8-12,20,23,26H,3,7,13H2,1-2H3,(H,24,25)/t20-,23-/m0/s1 |
| InChIKey | DSLHFPXAQOAEMY-REWPJTCUSA-N |
| XLogP | 4.70 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|